C28H25Cl2N3O — CID 22340272
4-(2,4-dichlorophenyl)-N-[2-(piperidin-1-ylmethyl)quinolin-6-yl]benzamide (PubChem CID 22340272) has the molecular formula C28H25Cl2N3O and a molecular weight of 490.43 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[2-(piperidin-1-ylmethyl)quinolin-6-yl]benzamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[2-(piperidin-1-ylmethyl)quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 22340272 |
| Molecular Formula | C28H25Cl2N3O |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[2-(piperidin-1-ylmethyl)quinolin-6-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(CN3CCCCC3)ccc2c1)c1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H25Cl2N3O/c29-22-9-12-25(26(30)17-22)19-4-6-20(7-5-19)28(34)32-23-11-13-27-21(16-23)8-10-24(31-27)18-33-14-2-1-3-15-33/h4-13,16-17H,1-3,14-15,18H2,(H,32,34) |
| InChIKey | SXUJLXBJOYNEJX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |