C19H15F2NO — CID 169229930
3-[2,5-bis(4-fluorophenyl)-1H-pyrrol-3-yl]propanal (PubChem CID 169229930) has the molecular formula C19H15F2NO and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[2,5-bis(4-fluorophenyl)-1H-pyrrol-3-yl]propanal.
| Compound Name | 3-[2,5-bis(4-fluorophenyl)-1H-pyrrol-3-yl]propanal |
|---|---|
| PubChem CID | 169229930 |
| Molecular Formula | C19H15F2NO |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[2,5-bis(4-fluorophenyl)-1H-pyrrol-3-yl]propanal |
| SMILES | O=CCCc1cc(-c2ccc(F)cc2)[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F2NO/c20-16-7-3-13(4-8-16)18-12-15(2-1-11-23)19(22-18)14-5-9-17(21)10-6-14/h3-12,22H,1-2H2 |
| InChIKey | ARNFNAMUTPBAEQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|