C24H19F3N6O3 — CID 169230842
3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-[N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]anilino]cyclobut-3-ene-1,2-dione (PubChem CID 169230842) has the molecular formula C24H19F3N6O3 and a molecular weight of 496.45 g/mol. Its IUPAC name is 3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-[N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-[N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 169230842 |
| Molecular Formula | C24H19F3N6O3 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 3-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-[N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]anilino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(N(Cc2ncc(-c3nnc(C(F)F)o3)cc2F)c2ccccc2)c(N2C[C@@H]3C[C@H]2CN3)c1=O |
| InChI | InChI=1S/C24H19F3N6O3/c25-16-6-12(23-30-31-24(36-23)22(26)27)8-29-17(16)11-33(14-4-2-1-3-5-14)19-18(20(34)21(19)35)32-10-13-7-15(32)9-28-13/h1-6,8,13,15,22,28H,7,9-11H2/t13-,15-/m0/s1 |
| InChIKey | LZHWASZVFPYREC-ZFWWWQNUSA-N |
| XLogP | 2.69 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|