C19H12F3N5O3 — CID 169230991
7-methoxy-6-nitro-4-[3-phenyl-1-(trifluoromethyl)pyrazol-4-yl]quinazoline (PubChem CID 169230991) has the molecular formula C19H12F3N5O3 and a molecular weight of 415.33 g/mol. Its IUPAC name is 7-methoxy-6-nitro-4-[3-phenyl-1-(trifluoromethyl)pyrazol-4-yl]quinazoline.
| Compound Name | 7-methoxy-6-nitro-4-[3-phenyl-1-(trifluoromethyl)pyrazol-4-yl]quinazoline |
|---|---|
| PubChem CID | 169230991 |
| Molecular Formula | C19H12F3N5O3 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 7-methoxy-6-nitro-4-[3-phenyl-1-(trifluoromethyl)pyrazol-4-yl]quinazoline |
| SMILES | COc1cc2ncnc(-c3cn(C(F)(F)F)nc3-c3ccccc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H12F3N5O3/c1-30-16-8-14-12(7-15(16)27(28)29)18(24-10-23-14)13-9-26(19(20,21)22)25-17(13)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | TZXLFJAPDGUPTJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|