C22H18F3N5O4S — CID 169231676
[4-(1-methyl-3-phenylpyrazol-4-yl)-6-(propanoylamino)quinazolin-7-yl] trifluoromethanesulfonate (PubChem CID 169231676) has the molecular formula C22H18F3N5O4S and a molecular weight of 505.48 g/mol. Its IUPAC name is [4-(1-methyl-3-phenylpyrazol-4-yl)-6-(propanoylamino)quinazolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-(1-methyl-3-phenylpyrazol-4-yl)-6-(propanoylamino)quinazolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169231676 |
| Molecular Formula | C22H18F3N5O4S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [4-(1-methyl-3-phenylpyrazol-4-yl)-6-(propanoylamino)quinazolin-7-yl] trifluoromethanesulfonate |
| SMILES | CCC(=O)Nc1cc2c(-c3cn(C)nc3-c3ccccc3)ncnc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H18F3N5O4S/c1-3-19(31)28-17-9-14-16(10-18(17)34-35(32,33)22(23,24)25)26-12-27-21(14)15-11-30(2)29-20(15)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3,(H,28,31) |
| InChIKey | VLOXCWCWSHXSCW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|