C25H29N5O3 — CID 169231723
1-methoxybutane;N-[7-methoxy-4-(1-methyl-3-phenylpyrazol-4-yl)quinazolin-6-yl]formamide (PubChem CID 169231723) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-methoxybutane;N-[7-methoxy-4-(1-methyl-3-phenylpyrazol-4-yl)quinazolin-6-yl]formamide.
| Compound Name | 1-methoxybutane;N-[7-methoxy-4-(1-methyl-3-phenylpyrazol-4-yl)quinazolin-6-yl]formamide |
|---|---|
| PubChem CID | 169231723 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-methoxybutane;N-[7-methoxy-4-(1-methyl-3-phenylpyrazol-4-yl)quinazolin-6-yl]formamide |
| SMILES | CCCCOC.COc1cc2ncnc(-c3cn(C)nc3-c3ccccc3)c2cc1NC=O |
| InChI | InChI=1S/C20H17N5O2.C5H12O/c1-25-10-15(19(24-25)13-6-4-3-5-7-13)20-14-8-17(23-12-26)18(27-2)9-16(14)21-11-22-20;1-3-4-5-6-2/h3-12H,1-2H3,(H,23,26);3-5H2,1-2H3 |
| InChIKey | QABYJVJBCNZBQV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|