C20H29NO2 — CID 169232093
1-hydroxy-N-[(1R,2R)-2-(4-phenylbutyl)cyclopropyl]cyclohexane-1-carboxamide (PubChem CID 169232093) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-hydroxy-N-[(1R,2R)-2-(4-phenylbutyl)cyclopropyl]cyclohexane-1-carboxamide.
| Compound Name | 1-hydroxy-N-[(1R,2R)-2-(4-phenylbutyl)cyclopropyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 169232093 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-hydroxy-N-[(1R,2R)-2-(4-phenylbutyl)cyclopropyl]cyclohexane-1-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]1CCCCc1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C20H29NO2/c22-19(20(23)13-7-2-8-14-20)21-18-15-17(18)12-6-5-11-16-9-3-1-4-10-16/h1,3-4,9-10,17-18,23H,2,5-8,11-15H2,(H,21,22)/t17-,18-/m1/s1 |
| InChIKey | GGZIZOMYSTUIRN-QZTJIDSGSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|