C13H17NO — CID 178170175
N-[2-(3-phenylpropyl)cyclopropyl]formamide (PubChem CID 178170175) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is N-[2-(3-phenylpropyl)cyclopropyl]formamide.
| Compound Name | N-[2-(3-phenylpropyl)cyclopropyl]formamide |
|---|---|
| PubChem CID | 178170175 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-[2-(3-phenylpropyl)cyclopropyl]formamide |
| SMILES | O=CNC1CC1CCCc1ccccc1 |
| InChI | InChI=1S/C13H17NO/c15-10-14-13-9-12(13)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,10,12-13H,4,7-9H2,(H,14,15) |
| InChIKey | QBEJRAZSFAYWKS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|