C19H22Cl2N2O4 — CID 169232213
3,5-dichloro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)-1-(2-methylpropoxy)propan-2-yl]pyridine-4-carboxamide (PubChem CID 169232213) has the molecular formula C19H22Cl2N2O4 and a molecular weight of 413.30 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)-1-(2-methylpropoxy)propan-2-yl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)-1-(2-methylpropoxy)propan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169232213 |
| Molecular Formula | C19H22Cl2N2O4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3,5-dichloro-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)-1-(2-methylpropoxy)propan-2-yl]pyridine-4-carboxamide |
| SMILES | CC(C)COC(O)[C@H](Cc1ccc(O)cc1)NC(=O)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O4/c1-11(2)10-27-19(26)16(7-12-3-5-13(24)6-4-12)23-18(25)17-14(20)8-22-9-15(17)21/h3-6,8-9,11,16,19,24,26H,7,10H2,1-2H3,(H,23,25)/t16-,19?/m0/s1 |
| InChIKey | POMRLSUEWGKFFW-UCFFOFKASA-N |
| XLogP | 3.43 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|