C19H21Cl2FN2O — CID 169234030
(Z)-N-[2-[6-(2,3-dichloro-4-fluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]ethyl]prop-1-en-1-amine (PubChem CID 169234030) has the molecular formula C19H21Cl2FN2O and a molecular weight of 383.29 g/mol. Its IUPAC name is (Z)-N-[2-[6-(2,3-dichloro-4-fluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]ethyl]prop-1-en-1-amine.
| Compound Name | (Z)-N-[2-[6-(2,3-dichloro-4-fluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]ethyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 169234030 |
| Molecular Formula | C19H21Cl2FN2O |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (Z)-N-[2-[6-(2,3-dichloro-4-fluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]ethyl]prop-1-en-1-amine |
| SMILES | C/C=C\NCCc1cc(C)c(OCC)c(-c2ccc(F)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C19H21Cl2FN2O/c1-4-9-23-10-8-13-11-12(3)19(25-5-2)18(24-13)14-6-7-15(22)17(21)16(14)20/h4,6-7,9,11,23H,5,8,10H2,1-3H3/b9-4- |
| InChIKey | VKZRIWXWZIKCLT-WTKPLQERSA-N |
| XLogP | 5.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|