C11H23NO2 — CID 169236804
5-(2-methoxyethoxy)-2,6-dimethylazepane (PubChem CID 169236804) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 5-(2-methoxyethoxy)-2,6-dimethylazepane.
| Compound Name | 5-(2-methoxyethoxy)-2,6-dimethylazepane |
|---|---|
| PubChem CID | 169236804 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 5-(2-methoxyethoxy)-2,6-dimethylazepane |
| SMILES | COCCOC1CCC(C)NCC1C |
| InChI | InChI=1S/C11H23NO2/c1-9-8-12-10(2)4-5-11(9)14-7-6-13-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | HPGBVNWQFBYYFJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|