C8H17NO2 — CID 99994836
(2S,4R)-4-(2-methoxyethoxy)-2-methylpyrrolidine (PubChem CID 99994836) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S,4R)-4-(2-methoxyethoxy)-2-methylpyrrolidine.
| Compound Name | (2S,4R)-4-(2-methoxyethoxy)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 99994836 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2S,4R)-4-(2-methoxyethoxy)-2-methylpyrrolidine |
| SMILES | COCCO[C@H]1CN[C@@H](C)C1 |
| InChI | InChI=1S/C8H17NO2/c1-7-5-8(6-9-7)11-4-3-10-2/h7-9H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | AUUMTOXCFLVOBA-JGVFFNPUSA-N |
| XLogP | 0.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|