C20H19F3N6O2 — CID 169238472
2-(4,4-difluoropiperidin-1-yl)-4-ethyl-6-[1-(2-fluoro-4-nitrophenyl)pyrazol-4-yl]pyrimidine (PubChem CID 169238472) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-4-ethyl-6-[1-(2-fluoro-4-nitrophenyl)pyrazol-4-yl]pyrimidine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-4-ethyl-6-[1-(2-fluoro-4-nitrophenyl)pyrazol-4-yl]pyrimidine |
|---|---|
| PubChem CID | 169238472 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-4-ethyl-6-[1-(2-fluoro-4-nitrophenyl)pyrazol-4-yl]pyrimidine |
| SMILES | CCc1cc(-c2cnn(-c3ccc([N+](=O)[O-])cc3F)c2)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C20H19F3N6O2/c1-2-14-9-17(26-19(25-14)27-7-5-20(22,23)6-8-27)13-11-24-28(12-13)18-4-3-15(29(30)31)10-16(18)21/h3-4,9-12H,2,5-8H2,1H3 |
| InChIKey | SNIQMLJYYGHAFJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|