C5H10F2N2O2S — CID 169240283
N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide (PubChem CID 169240283) has the molecular formula C5H10F2N2O2S and a molecular weight of 200.21 g/mol. Its IUPAC name is N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169240283 |
| Molecular Formula | C5H10F2N2O2S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CNCC1(F)F |
| InChI | InChI=1S/C5H10F2N2O2S/c1-12(10,11)9-4-2-8-3-5(4,6)7/h4,8-9H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | CDVFSMMKTWBRMV-SCSAIBSYSA-N |
| XLogP | -0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |