C21H22FN3OS2 — CID 169242514
N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)sulfanylpiperidine-4-carboxamide (PubChem CID 169242514) has the molecular formula C21H22FN3OS2 and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)sulfanylpiperidine-4-carboxamide.
| Compound Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)sulfanylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 169242514 |
| Molecular Formula | C21H22FN3OS2 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)sulfanylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)C3CCN(Sc4cccc(F)c4)CC3)sc2c1 |
| InChI | InChI=1S/C21H22FN3OS2/c1-13-10-14(2)19-18(11-13)27-21(23-19)24-20(26)15-6-8-25(9-7-15)28-17-5-3-4-16(22)12-17/h3-5,10-12,15H,6-9H2,1-2H3,(H,23,24,26) |
| InChIKey | OQHGASSHQWNMNW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|