C22H26ClN3OS2 — CID 169242490
1-(3-chlorophenyl)sulfanylpiperidine-4-carbaldehyde;N,4,6-trimethyl-1,3-benzothiazol-2-amine (PubChem CID 169242490) has the molecular formula C22H26ClN3OS2 and a molecular weight of 448.06 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanylpiperidine-4-carbaldehyde;N,4,6-trimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfanylpiperidine-4-carbaldehyde;N,4,6-trimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 169242490 |
| Molecular Formula | C22H26ClN3OS2 |
| Molecular Weight | 448.06 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanylpiperidine-4-carbaldehyde;N,4,6-trimethyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(C)cc(C)cc2s1.O=CC1CCN(Sc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14ClNOS.C10H12N2S/c13-11-2-1-3-12(8-11)16-14-6-4-10(9-15)5-7-14;1-6-4-7(2)9-8(5-6)13-10(11-3)12-9/h1-3,8-10H,4-7H2;4-5H,1-3H3,(H,11,12) |
| InChIKey | ZLGDJMOCLZBETI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.06 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|