C23H28FN3OS2 — CID 169242551
1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde;N,5,7-trimethyl-1,3-benzothiazol-2-amine (PubChem CID 169242551) has the molecular formula C23H28FN3OS2 and a molecular weight of 445.63 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde;N,5,7-trimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde;N,5,7-trimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 169242551 |
| Molecular Formula | C23H28FN3OS2 |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde;N,5,7-trimethyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2cc(C)cc(C)c2s1.Cc1cc(F)ccc1SN1CCC(C=O)CC1 |
| InChI | InChI=1S/C13H16FNOS.C10H12N2S/c1-10-8-12(14)2-3-13(10)17-15-6-4-11(9-16)5-7-15;1-6-4-7(2)9-8(5-6)12-10(11-3)13-9/h2-3,8-9,11H,4-7H2,1H3;4-5H,1-3H3,(H,11,12) |
| InChIKey | HUCKTWPSJJZQJG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|