C22H26FN3OS2 — CID 169242468
5,7-dimethyl-1,3-benzothiazol-2-amine;1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde (PubChem CID 169242468) has the molecular formula C22H26FN3OS2 and a molecular weight of 431.60 g/mol. Its IUPAC name is 5,7-dimethyl-1,3-benzothiazol-2-amine;1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde.
| Compound Name | 5,7-dimethyl-1,3-benzothiazol-2-amine;1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 169242468 |
| Molecular Formula | C22H26FN3OS2 |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 5,7-dimethyl-1,3-benzothiazol-2-amine;1-(4-fluoro-2-methylphenyl)sulfanylpiperidine-4-carbaldehyde |
| SMILES | Cc1cc(C)c2sc(N)nc2c1.Cc1cc(F)ccc1SN1CCC(C=O)CC1 |
| InChI | InChI=1S/C13H16FNOS.C9H10N2S/c1-10-8-12(14)2-3-13(10)17-15-6-4-11(9-16)5-7-15;1-5-3-6(2)8-7(4-5)11-9(10)12-8/h2-3,8-9,11H,4-7H2,1H3;3-4H,1-2H3,(H2,10,11) |
| InChIKey | DLAOFCKDNYJVEU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|