C23H25N7O3 — CID 169243197
6-[4-(2-cyano-2-hydroxypropoxy)phenyl]-4-[[(3S)-piperidin-3-yl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide (PubChem CID 169243197) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 6-[4-(2-cyano-2-hydroxypropoxy)phenyl]-4-[[(3S)-piperidin-3-yl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide.
| Compound Name | 6-[4-(2-cyano-2-hydroxypropoxy)phenyl]-4-[[(3S)-piperidin-3-yl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 169243197 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 6-[4-(2-cyano-2-hydroxypropoxy)phenyl]-4-[[(3S)-piperidin-3-yl]amino]pyrido[3,2-d]pyrimidine-8-carboxamide |
| SMILES | CC(O)(C#N)COc1ccc(-c2cc(C(N)=O)c3ncnc(N[C@H]4CCCNC4)c3n2)cc1 |
| InChI | InChI=1S/C23H25N7O3/c1-23(32,11-24)12-33-16-6-4-14(5-7-16)18-9-17(21(25)31)19-20(30-18)22(28-13-27-19)29-15-3-2-8-26-10-15/h4-7,9,13,15,26,32H,2-3,8,10,12H2,1H3,(H2,25,31)(H,27,28,29)/t15-,23?/m0/s1 |
| InChIKey | BCYJDUWIKBBXPO-NGMICRHFSA-N |
| XLogP | 1.61 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|