About 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium
1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium (PubChem CID 169244580) has the molecular formula C15H22F3N2+
and a molecular weight of 287.35 g/mol. Its IUPAC name is 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium.
Molecular Properties
| Compound Name | 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium |
| PubChem CID | 169244580 |
| Molecular Formula | C15H22F3N2+ |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium |
| SMILES | CC(C)N1C[N+](C)(C(C)C)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H22F3N2/c1-10(2)19-9-20(5,11(3)4)14-8-12(15(16,17)18)6-7-13(14)19/h6-8,10-11H,9H2,1-5H3/q+1 |
| InChIKey | GCBBNJZATDKEOK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium?
The IUPAC name of 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium (CID 169244580) is 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium.
What is the SMILES notation for 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium?
The canonical SMILES for 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium is CC(C)N1C[N+](C)(C(C)C)c2cc(C(F)(F)F)ccc21.
What is the InChIKey of 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium?
The InChIKey is GCBBNJZATDKEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F3N2/c1-10(2)19-9-20(5,11(3)4)14-8-12(15(16,17)18)6-7-13(14)19/h6-8,10-11H,9H2,1-5H3/q+1.
What are the key properties of 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium?
1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium has a molecular weight of 287.35 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,3-di(propan-2-yl)-6-(trifluoromethyl)-2H-benzimidazol-1-ium is sourced from PubChem (CID 169244580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).