C12H12F3NS — CID 158280479
1-propan-2-yl-5-(trifluoromethyl)-3H-indole-2-thione (PubChem CID 158280479) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-propan-2-yl-5-(trifluoromethyl)-3H-indole-2-thione.
| Compound Name | 1-propan-2-yl-5-(trifluoromethyl)-3H-indole-2-thione |
|---|---|
| PubChem CID | 158280479 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-propan-2-yl-5-(trifluoromethyl)-3H-indole-2-thione |
| SMILES | CC(C)N1C(=S)Cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H12F3NS/c1-7(2)16-10-4-3-9(12(13,14)15)5-8(10)6-11(16)17/h3-5,7H,6H2,1-2H3 |
| InChIKey | CPVLSSJDYTXHAI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|