C9H11BrFNS — CID 169245653
N-[1-(4-bromo-3-fluorothiophen-2-yl)ethyl]cyclopropanamine (PubChem CID 169245653) has the molecular formula C9H11BrFNS and a molecular weight of 264.16 g/mol. Its IUPAC name is N-[1-(4-bromo-3-fluorothiophen-2-yl)ethyl]cyclopropanamine.
| Compound Name | N-[1-(4-bromo-3-fluorothiophen-2-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 169245653 |
| Molecular Formula | C9H11BrFNS |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | N-[1-(4-bromo-3-fluorothiophen-2-yl)ethyl]cyclopropanamine |
| SMILES | CC(NC1CC1)c1scc(Br)c1F |
| InChI | InChI=1S/C9H11BrFNS/c1-5(12-6-2-3-6)9-8(11)7(10)4-13-9/h4-6,12H,2-3H2,1H3 |
| InChIKey | QVMBZKWTGNRPAN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |