C11H13Cl2N3 — CID 169246460
2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 169246460) has the molecular formula C11H13Cl2N3 and a molecular weight of 258.15 g/mol. Its IUPAC name is 2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 169246460 |
| Molecular Formula | C11H13Cl2N3 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(2,6-dichloropyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Clc1cc(N2CC3CCCC3C2)nc(Cl)n1 |
| InChI | InChI=1S/C11H13Cl2N3/c12-9-4-10(15-11(13)14-9)16-5-7-2-1-3-8(7)6-16/h4,7-8H,1-3,5-6H2 |
| InChIKey | UDDYCHIIMKCMDO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |