C8H5ClFN3S — CID 169247440
2-(6-chloro-4-fluoro-3-pyridinyl)-5-methyl-1,3,4-thiadiazole (PubChem CID 169247440) has the molecular formula C8H5ClFN3S and a molecular weight of 229.67 g/mol. Its IUPAC name is 2-(6-chloro-4-fluoro-3-pyridinyl)-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-(6-chloro-4-fluoro-3-pyridinyl)-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 169247440 |
| Molecular Formula | C8H5ClFN3S |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2-(6-chloro-4-fluoro-3-pyridinyl)-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(-c2cnc(Cl)cc2F)s1 |
| InChI | InChI=1S/C8H5ClFN3S/c1-4-12-13-8(14-4)5-3-11-7(9)2-6(5)10/h2-3H,1H3 |
| InChIKey | UJBUONXPBCEJFD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|