About ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate
ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate (PubChem CID 169247717) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate |
| PubChem CID | 169247717 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate |
| SMILES | CC.COC(=O)c1cc2c(nc1N1CCOCC1)COC2C |
| InChI | InChI=1S/C14H18N2O4.C2H6/c1-9-10-7-11(14(17)18-2)13(15-12(10)8-20-9)16-3-5-19-6-4-16;1-2/h7,9H,3-6,8H2,1-2H3;1-2H3 |
| InChIKey | NWLJLRNYSUTVJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate?
The IUPAC name of ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate (CID 169247717) is ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate.
What is the SMILES notation for ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate?
The canonical SMILES for ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate is CC.COC(=O)c1cc2c(nc1N1CCOCC1)COC2C.
What is the InChIKey of ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate?
The InChIKey is NWLJLRNYSUTVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4.C2H6/c1-9-10-7-11(14(17)18-2)13(15-12(10)8-20-9)16-3-5-19-6-4-16;1-2/h7,9H,3-6,8H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate?
ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate has a molecular weight of 308.38 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 5-methyl-2-morpholin-4-yl-5,7-dihydrofuro[3,4-b]pyridine-3-carboxylate is sourced from PubChem (CID 169247717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).