C12H14N4O4 — CID 155730948
methyl 7-amino-4-morpholin-4-yl-2,1,3-benzoxadiazole-5-carboxylate (PubChem CID 155730948) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 7-amino-4-morpholin-4-yl-2,1,3-benzoxadiazole-5-carboxylate.
| Compound Name | methyl 7-amino-4-morpholin-4-yl-2,1,3-benzoxadiazole-5-carboxylate |
|---|---|
| PubChem CID | 155730948 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methyl 7-amino-4-morpholin-4-yl-2,1,3-benzoxadiazole-5-carboxylate |
| SMILES | COC(=O)c1cc(N)c2nonc2c1N1CCOCC1 |
| InChI | InChI=1S/C12H14N4O4/c1-18-12(17)7-6-8(13)9-10(15-20-14-9)11(7)16-2-4-19-5-3-16/h6H,2-5,13H2,1H3 |
| InChIKey | VHCIQQDMBNNXBN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|