C23H22F4N4O5P+ — CID 169249493
2-[2-(1,1-difluoro-3,4-dihydroxyphosphinan-1-ium-4-yl)-6-(3,3-difluoro-1-hydroxycyclobutyl)-3-pyridinyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 169249493) has the molecular formula C23H22F4N4O5P+ and a molecular weight of 541.42 g/mol. Its IUPAC name is 2-[2-(1,1-difluoro-3,4-dihydroxyphosphinan-1-ium-4-yl)-6-(3,3-difluoro-1-hydroxycyclobutyl)-3-pyridinyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[2-(1,1-difluoro-3,4-dihydroxyphosphinan-1-ium-4-yl)-6-(3,3-difluoro-1-hydroxycyclobutyl)-3-pyridinyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 169249493 |
| Molecular Formula | C23H22F4N4O5P+ |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 2-[2-(1,1-difluoro-3,4-dihydroxyphosphinan-1-ium-4-yl)-6-(3,3-difluoro-1-hydroxycyclobutyl)-3-pyridinyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | NC(=O)c1nccc2[nH]c(-c3ccc(C4(O)CC(F)(F)C4)nc3C3(O)CC[P+](F)(F)CC3O)cc(=O)c12 |
| InChI | InChI=1S/C23H21F4N4O5P/c24-22(25)9-21(35,10-22)15-2-1-11(19(31-15)23(36)4-6-37(26,27)8-16(23)33)13-7-14(32)17-12(30-13)3-5-29-18(17)20(28)34/h1-3,5,7,16,33,35-36H,4,6,8-10H2,(H2-,28,29,30,32,34)/p+1 |
| InChIKey | PSWRVBKOTOIFNY-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|