C24H20F3NO2 — CID 169249509
2-[2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-5-(trifluoromethyl)phenyl]-1H-quinolin-4-one (PubChem CID 169249509) has the molecular formula C24H20F3NO2 and a molecular weight of 411.42 g/mol. Its IUPAC name is 2-[2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-5-(trifluoromethyl)phenyl]-1H-quinolin-4-one.
| Compound Name | 2-[2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-5-(trifluoromethyl)phenyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 169249509 |
| Molecular Formula | C24H20F3NO2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[2-[(2E,4Z)-2-ethenylhexa-2,4-dienoxy]-5-(trifluoromethyl)phenyl]-1H-quinolin-4-one |
| SMILES | C=C/C(=C\C=C/C)COc1ccc(C(F)(F)F)cc1-c1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C24H20F3NO2/c1-3-5-8-16(4-2)15-30-23-12-11-17(24(25,26)27)13-19(23)21-14-22(29)18-9-6-7-10-20(18)28-21/h3-14H,2,15H2,1H3,(H,28,29)/b5-3-,16-8+ |
| InChIKey | ZAFLSJFHSBFUIA-GYKTZEGQSA-N |
| XLogP | 6.28 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|