C29H18F6N2O4 — CID 169249690
2-[2-(3,4-difluoro-2-methoxyphenoxy)-5-fluoro-4-(trifluoromethyl)phenyl]-6-oxido-4-phenylmethoxy-1,6-naphthyridin-6-ium (PubChem CID 169249690) has the molecular formula C29H18F6N2O4 and a molecular weight of 572.46 g/mol. Its IUPAC name is 2-[2-(3,4-difluoro-2-methoxyphenoxy)-5-fluoro-4-(trifluoromethyl)phenyl]-6-oxido-4-phenylmethoxy-1,6-naphthyridin-6-ium.
| Compound Name | 2-[2-(3,4-difluoro-2-methoxyphenoxy)-5-fluoro-4-(trifluoromethyl)phenyl]-6-oxido-4-phenylmethoxy-1,6-naphthyridin-6-ium |
|---|---|
| PubChem CID | 169249690 |
| Molecular Formula | C29H18F6N2O4 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[2-(3,4-difluoro-2-methoxyphenoxy)-5-fluoro-4-(trifluoromethyl)phenyl]-6-oxido-4-phenylmethoxy-1,6-naphthyridin-6-ium |
| SMILES | COc1c(Oc2cc(C(F)(F)F)c(F)cc2-c2cc(OCc3ccccc3)c3c[n+]([O-])ccc3n2)ccc(F)c1F |
| InChI | InChI=1S/C29H18F6N2O4/c1-39-28-24(8-7-20(30)27(28)32)41-26-12-19(29(33,34)35)21(31)11-17(26)23-13-25(40-15-16-5-3-2-4-6-16)18-14-37(38)10-9-22(18)36-23/h2-14H,15H2,1H3 |
| InChIKey | GTYGCSOTQMVUQB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|