C29H33F2N2O4+ — CID 176996224
1,2-difluoro-3-methoxybenzene;ethane;6-hydroxy-2-(5-methyloxolan-2-yl)-4-phenylmethoxy-1,6-naphthyridin-6-ium (PubChem CID 176996224) has the molecular formula C29H33F2N2O4+ and a molecular weight of 511.59 g/mol. Its IUPAC name is 1,2-difluoro-3-methoxybenzene;ethane;6-hydroxy-2-(5-methyloxolan-2-yl)-4-phenylmethoxy-1,6-naphthyridin-6-ium.
| Compound Name | 1,2-difluoro-3-methoxybenzene;ethane;6-hydroxy-2-(5-methyloxolan-2-yl)-4-phenylmethoxy-1,6-naphthyridin-6-ium |
|---|---|
| PubChem CID | 176996224 |
| Molecular Formula | C29H33F2N2O4+ |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1,2-difluoro-3-methoxybenzene;ethane;6-hydroxy-2-(5-methyloxolan-2-yl)-4-phenylmethoxy-1,6-naphthyridin-6-ium |
| SMILES | CC.CC1CCC(c2cc(OCc3ccccc3)c3c[n+](O)ccc3n2)O1.COc1cccc(F)c1F |
| InChI | InChI=1S/C20H21N2O3.C7H6F2O.C2H6/c1-14-7-8-19(25-14)18-11-20(24-13-15-5-3-2-4-6-15)16-12-22(23)10-9-17(16)21-18;1-10-6-4-2-3-5(8)7(6)9;1-2/h2-6,9-12,14,19,23H,7-8,13H2,1H3;2-4H,1H3;1-2H3/q+1;; |
| InChIKey | AZDLPLRGSVOOTI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|