C20H26ClNOS — CID 169249888
6-(4-tert-butyl-5-chloro-2-methylphenyl)-2-methyl-3-propan-2-ylsulfanyl-1H-pyridin-4-one (PubChem CID 169249888) has the molecular formula C20H26ClNOS and a molecular weight of 363.95 g/mol. Its IUPAC name is 6-(4-tert-butyl-5-chloro-2-methylphenyl)-2-methyl-3-propan-2-ylsulfanyl-1H-pyridin-4-one.
| Compound Name | 6-(4-tert-butyl-5-chloro-2-methylphenyl)-2-methyl-3-propan-2-ylsulfanyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 169249888 |
| Molecular Formula | C20H26ClNOS |
| Molecular Weight | 363.95 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 6-(4-tert-butyl-5-chloro-2-methylphenyl)-2-methyl-3-propan-2-ylsulfanyl-1H-pyridin-4-one |
| SMILES | Cc1cc(C(C)(C)C)c(Cl)cc1-c1cc(=O)c(SC(C)C)c(C)[nH]1 |
| InChI | InChI=1S/C20H26ClNOS/c1-11(2)24-19-13(4)22-17(10-18(19)23)14-9-16(21)15(8-12(14)3)20(5,6)7/h8-11H,1-7H3,(H,22,23) |
| InChIKey | MITQIPGGVPOLKE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.95 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |