C19H19ClN2O — CID 169256145
2-(4-tert-butyl-5-chloro-2-methylphenyl)-1H-1,6-naphthyridin-4-one (PubChem CID 169256145) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-(4-tert-butyl-5-chloro-2-methylphenyl)-1H-1,6-naphthyridin-4-one.
| Compound Name | 2-(4-tert-butyl-5-chloro-2-methylphenyl)-1H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 169256145 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(4-tert-butyl-5-chloro-2-methylphenyl)-1H-1,6-naphthyridin-4-one |
| SMILES | Cc1cc(C(C)(C)C)c(Cl)cc1-c1cc(=O)c2cnccc2[nH]1 |
| InChI | InChI=1S/C19H19ClN2O/c1-11-7-14(19(2,3)4)15(20)8-12(11)17-9-18(23)13-10-21-6-5-16(13)22-17/h5-10H,1-4H3,(H,22,23) |
| InChIKey | SOIYOVLLSBXKAG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |