C35H40F3N3O2 — CID 169255345
ethane;4-methoxy-6-(trifluoromethyl)pyrimidine;8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 169255345) has the molecular formula C35H40F3N3O2 and a molecular weight of 591.72 g/mol. Its IUPAC name is ethane;4-methoxy-6-(trifluoromethyl)pyrimidine;8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | ethane;4-methoxy-6-(trifluoromethyl)pyrimidine;8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 169255345 |
| Molecular Formula | C35H40F3N3O2 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | ethane;4-methoxy-6-(trifluoromethyl)pyrimidine;8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC.COc1cc(C(F)(F)F)ncn1.c1ccc(C(OCC23CCCN2CCC3)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO.C6H5F3N2O.C2H6/c1-4-12-23(13-5-1)27(24-14-6-2-7-15-24,25-16-8-3-9-17-25)29-22-26-18-10-20-28(26)21-11-19-26;1-12-5-2-4(6(7,8)9)10-3-11-5;1-2/h1-9,12-17H,10-11,18-22H2;2-3H,1H3;1-2H3 |
| InChIKey | XPZRTIYYELPXCL-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|