C15H22F3N3O2S — CID 176939407
4-methoxy-2-(trifluoromethyl)pyrimidine;8-(methylsulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176939407) has the molecular formula C15H22F3N3O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-methoxy-2-(trifluoromethyl)pyrimidine;8-(methylsulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 4-methoxy-2-(trifluoromethyl)pyrimidine;8-(methylsulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176939407 |
| Molecular Formula | C15H22F3N3O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-methoxy-2-(trifluoromethyl)pyrimidine;8-(methylsulfanyloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | COc1ccnc(C(F)(F)F)n1.CSOCC12CCCN1CCC2 |
| InChI | InChI=1S/C9H17NOS.C6H5F3N2O/c1-12-11-8-9-4-2-6-10(9)7-3-5-9;1-12-4-2-3-10-5(11-4)6(7,8)9/h2-8H2,1H3;2-3H,1H3 |
| InChIKey | VDHNRGXZBOJAGP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|