C17H11F4N3O — CID 169259165
3-cyclopropyl-5-fluoro-8-[4-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidin-4-one (PubChem CID 169259165) has the molecular formula C17H11F4N3O and a molecular weight of 349.29 g/mol. Its IUPAC name is 3-cyclopropyl-5-fluoro-8-[4-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-5-fluoro-8-[4-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 169259165 |
| Molecular Formula | C17H11F4N3O |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 3-cyclopropyl-5-fluoro-8-[4-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(F)ncc(-c3ccc(C(F)(F)F)cc3)c2ncn1C1CC1 |
| InChI | InChI=1S/C17H11F4N3O/c18-15-13-14(23-8-24(16(13)25)11-5-6-11)12(7-22-15)9-1-3-10(4-2-9)17(19,20)21/h1-4,7-8,11H,5-6H2 |
| InChIKey | IFVPHTANQJGPRW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|