C18H14F3N3O — CID 169259170
3-cyclopropyl-8-[4-(1,1-difluoroethyl)phenyl]-5-fluoropyrido[4,3-d]pyrimidin-4-one (PubChem CID 169259170) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-cyclopropyl-8-[4-(1,1-difluoroethyl)phenyl]-5-fluoropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-8-[4-(1,1-difluoroethyl)phenyl]-5-fluoropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 169259170 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-cyclopropyl-8-[4-(1,1-difluoroethyl)phenyl]-5-fluoropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(F)(F)c1ccc(-c2cnc(F)c3c(=O)n(C4CC4)cnc23)cc1 |
| InChI | InChI=1S/C18H14F3N3O/c1-18(20,21)11-4-2-10(3-5-11)13-8-22-16(19)14-15(13)23-9-24(17(14)25)12-6-7-12/h2-5,8-9,12H,6-7H2,1H3 |
| InChIKey | RBRTYGHXSCUEBC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|