C19H17F3N4O2 — CID 169259568
5-[[8-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazin-5-yl]amino]oxan-3-ol (PubChem CID 169259568) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 5-[[8-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazin-5-yl]amino]oxan-3-ol.
| Compound Name | 5-[[8-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazin-5-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 169259568 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-[[8-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]pyrazin-5-yl]amino]oxan-3-ol |
| SMILES | OC1COCC(Nc2ncc(-c3ccc(C(F)(F)F)cc3)c3nccnc23)C1 |
| InChI | InChI=1S/C19H17F3N4O2/c20-19(21,22)12-3-1-11(2-4-12)15-8-25-18(17-16(15)23-5-6-24-17)26-13-7-14(27)10-28-9-13/h1-6,8,13-14,27H,7,9-10H2,(H,25,26) |
| InChIKey | FLPLNWRWLOOZOS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |