C14H17F6N5O — CID 169260259
2,6-diamino-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one;trifluoromethylcyclohexane (PubChem CID 169260259) has the molecular formula C14H17F6N5O and a molecular weight of 385.31 g/mol. Its IUPAC name is 2,6-diamino-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one;trifluoromethylcyclohexane.
| Compound Name | 2,6-diamino-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one;trifluoromethylcyclohexane |
|---|---|
| PubChem CID | 169260259 |
| Molecular Formula | C14H17F6N5O |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2,6-diamino-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one;trifluoromethylcyclohexane |
| SMILES | FC(F)(F)C1CCCCC1.Nc1nc2c(c(C(F)(F)F)n1)C(=O)N(N)C2 |
| InChI | InChI=1S/C7H6F3N5O.C7H11F3/c8-7(9,10)4-3-2(13-6(11)14-4)1-15(12)5(3)16;8-7(9,10)6-4-2-1-3-5-6/h1,12H2,(H2,11,13,14);6H,1-5H2 |
| InChIKey | RAUJZDUKFPSABV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|