C16H19F3N4O — CID 169260276
acetylene;2-amino-6-(cyclohexylmethyl)-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 169260276) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is acetylene;2-amino-6-(cyclohexylmethyl)-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | acetylene;2-amino-6-(cyclohexylmethyl)-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 169260276 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | acetylene;2-amino-6-(cyclohexylmethyl)-4-(trifluoromethyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | C#C.Nc1nc2c(c(C(F)(F)F)n1)C(=O)N(CC1CCCCC1)C2 |
| InChI | InChI=1S/C14H17F3N4O.C2H2/c15-14(16,17)11-10-9(19-13(18)20-11)7-21(12(10)22)6-8-4-2-1-3-5-8;1-2/h8H,1-7H2,(H2,18,19,20);1-2H |
| InChIKey | AXOWBTCRRNBKKG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|