C16H22F2N4O — CID 169260267
acetylene;2-amino-4-(difluoromethyl)-6-methyl-7H-pyrrolo[3,4-d]pyrimidin-5-one;cyclohexane (PubChem CID 169260267) has the molecular formula C16H22F2N4O and a molecular weight of 324.38 g/mol. Its IUPAC name is acetylene;2-amino-4-(difluoromethyl)-6-methyl-7H-pyrrolo[3,4-d]pyrimidin-5-one;cyclohexane.
| Compound Name | acetylene;2-amino-4-(difluoromethyl)-6-methyl-7H-pyrrolo[3,4-d]pyrimidin-5-one;cyclohexane |
|---|---|
| PubChem CID | 169260267 |
| Molecular Formula | C16H22F2N4O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | acetylene;2-amino-4-(difluoromethyl)-6-methyl-7H-pyrrolo[3,4-d]pyrimidin-5-one;cyclohexane |
| SMILES | C#C.C1CCCCC1.CN1Cc2nc(N)nc(C(F)F)c2C1=O |
| InChI | InChI=1S/C8H8F2N4O.C6H12.C2H2/c1-14-2-3-4(7(14)15)5(6(9)10)13-8(11)12-3;1-2-4-6-5-3-1;1-2/h6H,2H2,1H3,(H2,11,12,13);1-6H2;1-2H |
| InChIKey | GHLSAPMVIRLTAB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|