C22H21N3O6S2 — CID 16926172
N-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-4-nitrobenzenesulfonamide (PubChem CID 16926172) has the molecular formula C22H21N3O6S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 16926172 |
| Molecular Formula | C22H21N3O6S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3ccc(NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)cc3C2)cc1 |
| InChI | InChI=1S/C22H21N3O6S2/c1-16-2-8-22(9-3-16)33(30,31)24-13-12-17-4-5-19(14-18(17)15-24)23-32(28,29)21-10-6-20(7-11-21)25(26)27/h2-11,14,23H,12-13,15H2,1H3 |
| InChIKey | XYWPRXHPLZHBMO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|