C28H26ClF3N4O2 — CID 169264624
4-amino-N-[(2R)-2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide (PubChem CID 169264624) has the molecular formula C28H26ClF3N4O2 and a molecular weight of 542.99 g/mol. Its IUPAC name is 4-amino-N-[(2R)-2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide.
| Compound Name | 4-amino-N-[(2R)-2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264624 |
| Molecular Formula | C28H26ClF3N4O2 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 4-amino-N-[(2R)-2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@H](c2ccc(F)c(-c3cc(Cl)c(F)cc3F)n2)C2CC2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C28H26ClF3N4O2/c1-38-25-9-15(8-16(26(25)33)12-34-17-4-5-17)28(37)35-13-19(14-2-3-14)24-7-6-21(30)27(36-24)18-10-20(29)23(32)11-22(18)31/h6-12,14,17,19H,2-5,13,33H2,1H3,(H,35,37)/b34-12+/t19-/m0/s1 |
| InChIKey | WERAWGSKZLYWEB-WNRLCGNTSA-N |
| XLogP | 5.91 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|