C23H19Cl2F3N3O4S- — CID 69181161
5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]-3-methoxybenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine (PubChem CID 69181161) has the molecular formula C23H19Cl2F3N3O4S- and a molecular weight of 561.39 g/mol. Its IUPAC name is 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]-3-methoxybenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]-3-methoxybenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 69181161 |
| Molecular Formula | C23H19Cl2F3N3O4S- |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 5-[[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]-3-methoxybenzoyl]amino]methyl]-2-(trifluoromethyl)pyridine |
| SMILES | COc1cc(C(=O)NCc2ccc(C(F)(F)F)nc2)ccc1N(CCc1cccc(Cl)c1Cl)S(=O)[O-] |
| InChI | InChI=1S/C23H20Cl2F3N3O4S/c1-35-19-11-16(22(32)30-13-14-5-8-20(29-12-14)23(26,27)28)6-7-18(19)31(36(33)34)10-9-15-3-2-4-17(24)21(15)25/h2-8,11-12H,9-10,13H2,1H3,(H,30,32)(H,33,34)/p-1 |
| InChIKey | ZIVXLDCWYTXMLJ-UHFFFAOYSA-M |
| XLogP | 5.19 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|