C22H28F2INO2S — CID 169264678
ethane;[2-[5-fluoro-6-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(2-methylcyclopropyl)ethoxy] thiohypoiodite (PubChem CID 169264678) has the molecular formula C22H28F2INO2S and a molecular weight of 535.44 g/mol. Its IUPAC name is ethane;[2-[5-fluoro-6-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(2-methylcyclopropyl)ethoxy] thiohypoiodite.
| Compound Name | ethane;[2-[5-fluoro-6-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(2-methylcyclopropyl)ethoxy] thiohypoiodite |
|---|---|
| PubChem CID | 169264678 |
| Molecular Formula | C22H28F2INO2S |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | ethane;[2-[5-fluoro-6-(4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(2-methylcyclopropyl)ethoxy] thiohypoiodite |
| SMILES | CC.CC1CC1C(COSI)c1cc(C(C)(C)O)c(F)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H22F2INO2S.C2H6/c1-11-8-14(11)15(10-26-27-23)17-9-16(20(2,3)25)18(22)19(24-17)12-4-6-13(21)7-5-12;1-2/h4-7,9,11,14-15,25H,8,10H2,1-3H3;1-2H3 |
| InChIKey | KFSKPVHUFOTEOA-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|