C32H33ClF3N3O — CID 169264858
8-butan-2-yl-3,6-dimethylquinoline;N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]formamide (PubChem CID 169264858) has the molecular formula C32H33ClF3N3O and a molecular weight of 568.08 g/mol. Its IUPAC name is 8-butan-2-yl-3,6-dimethylquinoline;N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]formamide.
| Compound Name | 8-butan-2-yl-3,6-dimethylquinoline;N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]formamide |
|---|---|
| PubChem CID | 169264858 |
| Molecular Formula | C32H33ClF3N3O |
| Molecular Weight | 568.08 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 8-butan-2-yl-3,6-dimethylquinoline;N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]-2-cyclopropylethyl]formamide |
| SMILES | CCC(C)c1cc(C)cc2cc(C)cnc12.O=CNCC(c1ccc(F)c(-c2cc(Cl)c(F)cc2F)n1)C1CC1 |
| InChI | InChI=1S/C17H14ClF3N2O.C15H19N/c18-12-5-10(14(20)6-15(12)21)17-13(19)3-4-16(23-17)11(7-22-8-24)9-1-2-9;1-5-12(4)14-8-10(2)6-13-7-11(3)9-16-15(13)14/h3-6,8-9,11H,1-2,7H2,(H,22,24);6-9,12H,5H2,1-4H3 |
| InChIKey | QDDCWLKQSXQBDO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.08 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|