C32H32F8N4O3 — CID 169265034
4-amino-N-[2-cyclopropyl-2-[5-fluoro-6-(4-fluorophenyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-(cyclopropyliminomethyl)benzamide;methoxymethane (PubChem CID 169265034) has the molecular formula C32H32F8N4O3 and a molecular weight of 672.62 g/mol. Its IUPAC name is 4-amino-N-[2-cyclopropyl-2-[5-fluoro-6-(4-fluorophenyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-(cyclopropyliminomethyl)benzamide;methoxymethane.
| Compound Name | 4-amino-N-[2-cyclopropyl-2-[5-fluoro-6-(4-fluorophenyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-(cyclopropyliminomethyl)benzamide;methoxymethane |
|---|---|
| PubChem CID | 169265034 |
| Molecular Formula | C32H32F8N4O3 |
| Molecular Weight | 672.62 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 4-amino-N-[2-cyclopropyl-2-[5-fluoro-6-(4-fluorophenyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-(cyclopropyliminomethyl)benzamide;methoxymethane |
| SMILES | COC.Nc1ccc(C(=O)NCC(c2cc(C(O)(C(F)(F)F)C(F)(F)F)c(F)c(-c3ccc(F)cc3)n2)C2CC2)cc1/C=N/C1CC1 |
| InChI | InChI=1S/C30H26F8N4O2.C2H6O/c31-19-6-3-16(4-7-19)26-25(32)22(28(44,29(33,34)35)30(36,37)38)12-24(42-26)21(15-1-2-15)14-41-27(43)17-5-10-23(39)18(11-17)13-40-20-8-9-20;1-3-2/h3-7,10-13,15,20-21,44H,1-2,8-9,14,39H2,(H,41,43);1-2H3/b40-13+; |
| InChIKey | CESFWAHHXQTBSC-USOQUKNKSA-N |
| XLogP | 6.69 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|