C36H33ClF3N5O3 — CID 169265015
6-[2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-(1-methylcyclopropyl)pyridine-4-carboxamide (PubChem CID 169265015) has the molecular formula C36H33ClF3N5O3 and a molecular weight of 676.14 g/mol. Its IUPAC name is 6-[2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-(1-methylcyclopropyl)pyridine-4-carboxamide.
| Compound Name | 6-[2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-(1-methylcyclopropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169265015 |
| Molecular Formula | C36H33ClF3N5O3 |
| Molecular Weight | 676.14 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | 6-[2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-(1-methylcyclopropyl)pyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)NCC(c2ccccc2)c2cc(C(=O)NC3(C)CC3)c(F)c(-c3cc(Cl)c(F)cc3F)n2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C36H33ClF3N5O3/c1-36(10-11-36)45-35(47)24-15-29(44-33(31(24)40)23-14-26(37)28(39)16-27(23)38)25(19-6-4-3-5-7-19)18-43-34(46)20-12-21(17-42-22-8-9-22)32(41)30(13-20)48-2/h3-7,12-17,22,25H,8-11,18,41H2,1-2H3,(H,43,46)(H,45,47)/b42-17+ |
| InChIKey | BXDMKYAYSLTOPO-OLUOZRNISA-N |
| XLogP | 6.84 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.14 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|