C33H29ClF3N5O4 — CID 169264848
6-[(1S)-2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-methylpyridine-4-carboxamide (PubChem CID 169264848) has the molecular formula C33H29ClF3N5O4 and a molecular weight of 652.07 g/mol. Its IUPAC name is 6-[(1S)-2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-methylpyridine-4-carboxamide.
| Compound Name | 6-[(1S)-2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 169264848 |
| Molecular Formula | C33H29ClF3N5O4 |
| Molecular Weight | 652.07 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | 6-[(1S)-2-[[4-amino-3-(cyclopropyliminomethyl)-5-methoxybenzoyl]amino]-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc([C@@](O)(CNC(=O)c2cc(/C=N/C3CC3)c(N)c(OC)c2)c2ccccc2)nc(-c2cc(Cl)c(F)cc2F)c1F |
| InChI | InChI=1S/C33H29ClF3N5O4/c1-39-32(44)22-13-27(42-30(28(22)37)21-12-23(34)25(36)14-24(21)35)33(45,19-6-4-3-5-7-19)16-41-31(43)17-10-18(15-40-20-8-9-20)29(38)26(11-17)46-2/h3-7,10-15,20,45H,8-9,16,38H2,1-2H3,(H,39,44)(H,41,43)/b40-15+/t33-/m1/s1 |
| InChIKey | ZZFRNRPPZXTBKM-JKMJKJNTSA-N |
| XLogP | 5.02 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.07 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|