C34H34Cl2N4O3 — CID 169264829
4-amino-3-(cyclopropyliminomethyl)-N-[2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide (PubChem CID 169264829) has the molecular formula C34H34Cl2N4O3 and a molecular weight of 617.58 g/mol. Its IUPAC name is 4-amino-3-(cyclopropyliminomethyl)-N-[2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide.
| Compound Name | 4-amino-3-(cyclopropyliminomethyl)-N-[2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264829 |
| Molecular Formula | C34H34Cl2N4O3 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | 4-amino-3-(cyclopropyliminomethyl)-N-[2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2ccccc2)c2cc(C(C)(C)O)cc(-c3cccc(Cl)c3Cl)n2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C34H34Cl2N4O3/c1-34(2,42)23-16-28(25-10-7-11-27(35)31(25)36)40-29(17-23)26(20-8-5-4-6-9-20)19-39-33(41)21-14-22(18-38-24-12-13-24)32(37)30(15-21)43-3/h4-11,14-18,24,26,42H,12-13,19,37H2,1-3H3,(H,39,41)/b38-18+ |
| InChIKey | QXMQCRVETPWGRY-CDLBOOTPSA-N |
| XLogP | 7.02 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|