C32H28Cl2F4N4O3 — CID 169265037
4-amino-N-[2-[6-(2,3-dichlorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(3-fluorophenyl)ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide (PubChem CID 169265037) has the molecular formula C32H28Cl2F4N4O3 and a molecular weight of 663.50 g/mol. Its IUPAC name is 4-amino-N-[2-[6-(2,3-dichlorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(3-fluorophenyl)ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[6-(2,3-dichlorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(3-fluorophenyl)ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 169265037 |
| Molecular Formula | C32H28Cl2F4N4O3 |
| Molecular Weight | 663.50 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | 4-amino-N-[2-[6-(2,3-dichlorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-(3-fluorophenyl)ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2cccc(F)c2)c2cc(C(C)(C)O)c(F)c(-c3cccc(Cl)c3Cl)n2)cc(/C=N/C(F)F)c1N |
| InChI | InChI=1S/C32H28Cl2F4N4O3/c1-32(2,44)22-13-24(42-29(27(22)36)20-8-5-9-23(33)26(20)34)21(16-6-4-7-19(35)11-16)15-40-30(43)17-10-18(14-41-31(37)38)28(39)25(12-17)45-3/h4-14,21,31,44H,15,39H2,1-3H3,(H,40,43)/b41-14+ |
| InChIKey | ZTDVIFYMYJJBOW-GKNFWFERSA-N |
| XLogP | 7.36 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.50 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|